
Catalog Number	AR00DLG0
Chemical Name	2-(6-methyl-1H-indol-3-yl)acetic acid
CAS Number	52531-20-1
Molecular Formula	C11H11NO2
Molecular Weight	189.2105
MDL Number	MFCD10035273
SMILES	OC(=O)Cc1c[nH]c2c1ccc(c2)C

2-(6-Methyl-1H-indol-3-yl)acetic acid, also known as $name$, is a versatile compound widely used in chemical synthesis. Its primary application lies in its ability to serve as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and functional materials.In chemical synthesis, $name$ plays a crucial role as a building block for the synthesis of biologically active compounds, particularly those with indole-based structures. Its unique molecular structure allows for diverse functionalization and modification, making it a valuable starting material in the development of new molecules with desired properties.Furthermore, the presence of the indole moiety in $name$ confers biological relevance to the synthesized compounds, as indole derivatives are known to exhibit a wide range of pharmacological activities, including anti-inflammatory, anti-cancer, and antimicrobial properties. This makes $name$ a valuable tool for medicinal chemists and researchers in the development of novel drug candidates.Overall, the application of 2-(6-Methyl-1H-indol-3-yl)acetic acid in chemical synthesis extends far beyond its role as a simple intermediate, offering a gateway to the creation of diverse and biologically significant molecules with potential applications in various fields of science and industry.