
Catalog Number	AR003IWR
Chemical Name	3-(Dimethylamino)-1-(4-methylphenyl)propan-1-one Hydrochloride
CAS Number	5250-02-2
Molecular Formula	C12H18ClNO
Molecular Weight	227.7304
MDL Number	MFCD00156711
SMILES	CN(CCC(=O)c1ccc(cc1)C)C.Cl

3-(Dimethylamino)-1-(4-methylphenyl)propan-1-one Hydrochloride is commonly used as a key intermediate in chemical synthesis processes. This compound serves as a versatile building block in various organic reactions, especially in the production of pharmaceuticals, agrochemicals, and specialty chemicals.One primary application of 3-(Dimethylamino)-1-(4-methylphenyl)propan-1-one Hydrochloride is in the synthesis of complex organic molecules through N-alkylation reactions. By utilizing this compound as a reagent, chemists can efficiently introduce the dimethylamino and methylphenyl groups into target molecules, thereby enabling the formation of structurally diverse compounds.Additionally, 3-(Dimethylamino)-1-(4-methylphenyl)propan-1-one Hydrochloride is often employed in the preparation of chiral compounds via asymmetric synthesis. Its specific stereochemical properties make it a valuable tool for the creation of enantiomerically pure products with high optical purity, which is crucial in the development of pharmaceuticals and fine chemicals.Furthermore, this compound can participate in various functional group transformations, such as acylation, alkylation, and cyclization reactions, allowing chemists to tailor the structure and properties of the final products according to desired specifications. Its compatibility with a wide range of reaction conditions makes it a versatile reagent in modern organic synthesis strategies.