
Catalog Number	AR00D9WO
Chemical Name	(2S,3S,4R)-2-CARBOXY-4-ISOPROPYL-3-PYRROLIDINEACETIC ACID
CAS Number	52497-36-6
Molecular Formula	C10H17NO4
Molecular Weight	215.2463
MDL Number	MFCD03412037
SMILES	OC(=O)C[C@H]1[C@H](CN[C@@H]1C(=O)O)C(C)C

Dihydrokainic acid, also known as DHK, is a key molecule used in chemical synthesis for its versatile applications in the production of pharmaceuticals, agrochemicals, and materials science. This compound acts as a valuable intermediate in the synthesis of various drugs, including anticancer agents and antibiotics. Due to its unique structure and reactivity, DHK serves as a vital building block in the creation of complex organic molecules through diverse chemical transformations. Its functional groups enable efficient coupling reactions and provide opportunities for the introduction of specific substituents, facilitating the design and development of novel compounds with enhanced biological activities. In addition to its role in pharmaceutical synthesis, DHK also finds use in the preparation of specialized materials such as polymers and catalysts, highlighting its importance in advancing various fields of chemistry.