
Catalog Number	AR00DFEC
Chemical Name	4-Nitrophenyl phosphate bis(cyclohexylammonium) salt
CAS Number	52483-84-8
Molecular Formula	C18H32N3O6P
Molecular Weight	417.4369
MDL Number	MFCD00066287
SMILES	[O-][N+](=O)c1ccc(cc1)OP(=O)(O)O.NC1CCCCC1.NC1CCCCC1

4-Nitrophenyl phosphate bis(cyclohexylammonium) salt is a versatile compound widely used in chemical synthesis as a potent phosphorylating agent. Its superior reactivity and specificity make it an essential tool for researchers and chemists working in various fields such as organic synthesis, biochemistry, and medicinal chemistry.This specialty salt offers a convenient and efficient way to introduce phosphate groups into organic molecules, a crucial step in many chemical reactions and biological processes. Its unique properties allow for precise control over the phosphorylation process, resulting in high yields and purity of the desired products.Whether used for the synthesis of pharmaceuticals, agrochemicals, or advanced materials, 4-Nitrophenyl phosphate bis(cyclohexylammonium) salt enables chemists to efficiently modify and functionalize molecules with phosphate groups, opening up a wide range of possibilities for the development of new compounds and materials.