
Catalog Number	AR00DDSZ
Chemical Name	8-chloro-2-methylquinoline-4-carboxylic acid(SALTDATA
CAS Number	52413-67-9
Molecular Formula	C11H8ClNO2
Molecular Weight	221.6397
MDL Number	MFCD00487565
SMILES	Cc1cc(C(=O)O)c2c(n1)c(Cl)ccc2

8-Chloro-2-methylquinoline-4-carboxylic acid is a versatile chemical compound widely utilized in chemical synthesis processes due to its unique properties and reactivity. In organic synthesis, this compound serves as a key building block for the creation of various pharmaceuticals, agrochemicals, and materials. Its functional groups allow for facile derivatization and incorporation into complex molecular structures, making it a valuable tool in the development of novel compounds with tailored properties. Additionally, its chlorine substituent and quinoline core provide opportunities for selective transformations and diversification through various reaction pathways, enabling the synthesis of structurally diverse molecules.