
Catalog Number	AR00DME8
Chemical Name	3-bromo-8-nitroimidazo[1,2-a]pyridine
CAS Number	52310-43-7
Molecular Formula	C7H4BrN3O2
Molecular Weight	242.0296
MDL Number	MFCD17016106
SMILES	[O-][N+](=O)c1cccn2c1ncc2Br

3-Bromo-8-nitroimidazo[1,2-a]pyridine serves as a versatile building block in chemical synthesis, particularly in the development of pharmaceutical compounds and agrochemicals. This compound is widely utilized as a key intermediate in the synthesis of various heterocyclic compounds due to its unique structure and functional groups. In organic synthesis, 3-Bromo-8-nitroimidazo[1,2-a]pyridine can be employed for the modification of molecular structures, enabling the creation of new chemical entities with desired properties. Additionally, its reactivity and compatibility with different reaction conditions make it a valuable tool for medicinal chemistry and material science research. The strategic incorporation of 3-Bromo-8-nitroimidazo[1,2-a]pyridine into synthetic routes allows for the efficient construction of complex molecules, showcasing its importance in modern chemical synthesis strategies.