
Catalog Number	AR00DBJZ
Chemical Name	(2-chloro-4-formylphenoxy)acetic acid
CAS Number	52268-20-9
Molecular Formula	C9H7ClO4
Molecular Weight	214.6025
MDL Number	MFCD03030919
SMILES	O=Cc1ccc(c(c1)Cl)OCC(=O)O

The versatile compound 2-(2-Chloro-4-formylphenoxy)acetic acid plays a crucial role in chemical synthesis as a key building block for the creation of various organic molecules. With its unique structure and reactivity, this compound is commonly employed in the production of pharmaceuticals, agrochemicals, and specialty chemicals.By serving as a starting material or intermediate in multistep synthesis pathways, 2-(2-Chloro-4-formylphenoxy)acetic acid enables the introduction of specific functional groups and structural motifs into target molecules. Its chloro and formyl groups offer strategic points for further derivatization, allowing chemists to tailor the properties of the final products for specific applications.In addition to its use in organic synthesis, this compound also finds applications in the development of advanced materials, catalysts, and bioactive compounds. The ability of 2-(2-Chloro-4-formylphenoxy)acetic acid to participate in diverse chemical reactions makes it a valuable tool for researchers and industrial chemists seeking to innovate in various fields of chemistry and beyond.