
Catalog Number	AR00D9VU
Chemical Name	Z-D-LEU-ONP
CAS Number	52235-17-3
Molecular Formula	C20H22N2O6
Molecular Weight	386.3985
MDL Number	MFCD00153338
SMILES	CC(C[C@H](C(=O)Oc1ccc(cc1)[N+](=O)[O-])NC(=O)OCc1ccccc1)C

The compound D-Leucine, N-[(phenylmethoxy)carbonyl]-, 4-nitrophenyl ester serves as a versatile reagent in chemical synthesis. Due to its unique structure, it plays a crucial role in peptide synthesis by selectively protecting the amino group of D-Leucine. This protection is vital in controlling the reactivity of the amino group during subsequent reactions, ensuring the desired chemical transformations occur at specific sites within the peptide chain. Additionally, the 4-nitrophenyl ester moiety facilitates efficient purification of the peptide product through solid-phase extraction techniques, making it an essential tool for synthetic chemists aiming to produce high-quality peptides with precision and purity.