
Catalog Number	AR00DG5D
Chemical Name	Echimidine
CAS Number	520-68-3
Molecular Formula	C20H31NO7
Molecular Weight	397.4626
MDL Number	MFCD02656389
SMILES	C/C=C(C(=O)O[C@@H]1CCN2[C@@H]1C(=CC2)COC(=O)[C@](C(O)(C)C)([C@@H](O)C)O)/C

The compound (+)-Echimidine, a natural product derived from certain plant sources, serves as a valuable tool in chemical synthesis. Its ability to act as a chiral auxiliary plays a crucial role in creating enantiomerically pure molecules. By leveraging the unique structural features of (+)-Echimidine, chemists can facilitate asymmetric transformations and efficiently access a wide range of optically active compounds. This versatile compound has found applications in various synthetic pathways, contributing significantly to the development of complex molecules with high stereochemical control.