
Catalog Number	AR00J1RL
Chemical Name	[1-(6-methoxy-2-naphthyl)ethyl]amine hydrochloride
CAS Number	51872-03-8
Molecular Formula	C13H16ClNO
Molecular Weight	237.72523999999999
MDL Number	MFCD11841222
SMILES	COc1ccc2c(c1)ccc(c2)C(N)C.Cl

The compound 1-(6-methoxynaphthalen-2-yl)ethan-1-amine hydrochloride is utilized in chemical synthesis as a versatile building block for the creation of various organic molecules. Due to its unique structure and reactivity, it serves as an important intermediate in the synthesis of pharmaceuticals, agrochemicals, and materials. Its functional groups make it a valuable precursor in the formation of complex organic compounds through a variety of synthetic pathways. The presence of an amine group allows for further derivatization, enabling the introduction of different functional groups to tailor the properties of the final products. This compound plays a crucial role in the development of novel molecules with potential applications in drug discovery, material science, and other areas of chemical research.