
Catalog Number	AR00D8X4
Chemical Name	ASP-ARG-VAL-TYR-ILE-HIS-PRO
CAS Number	51833-78-4
Molecular Formula	C41H62N12O11
Molecular Weight	899.0048
MDL Number	MFCD00153513
SMILES	CC[C@@H]([C@@H](C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)O)Cc1nc[nH]c1)NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)N)CCCNC(=N)N)Cc1ccc(cc1)O)C

Angiotensin 1-7 is a biologically active peptide that plays a crucial role in regulating blood pressure and cardiovascular function. In the field of chemical synthesis, Angiotensin 1-7 is utilized as a key building block for the creation of novel peptide-based drugs and therapeutic agents. Its unique structure and biological properties make it an attractive target for researchers seeking to develop new pharmaceutical compounds.One of the primary applications of Angiotensin 1-7 in chemical synthesis is its use as a starting material for the development of analogs and derivatives with enhanced biological activity or improved pharmacokinetic properties. By modifying specific amino acid residues or altering the peptide backbone, chemists can fine-tune the potency and selectivity of Angiotensin 1-7 analogs to target specific pathways or receptors involved in cardiovascular regulation.Furthermore, Angiotensin 1-7 can serve as a template for the design and synthesis of peptidomimetics, which are non-peptide compounds that mimic the structure and function of natural peptides. These peptidomimetics can exhibit improved stability, bioavailability, and therapeutic potential compared to the original peptide sequence, making them valuable candidates for drug development.Overall, the versatility and biological significance of Angiotensin 1-7 make it a valuable tool in chemical synthesis for creating innovative peptide-based drugs with potential applications in the treatment of hypertension, heart failure, and other cardiovascular disorders.