
Catalog Number	AR00D94R
Chemical Name	tert-butyl 3-cyanomorpholine-4-carboxylate
CAS Number	518047-40-0
Molecular Formula	C10H16N2O3
Molecular Weight	212.2456
MDL Number	MFCD09863125
SMILES	N#CC1COCCN1C(=O)OC(C)(C)C

A versatile and valuable compound in chemical synthesis, tert-Butyl 3-cyanomorpholine-4-carboxylate is commonly utilized as a key building block in the creation of various organic molecules. Due to its unique structure and reactivity, this compound serves as a crucial intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. By incorporating tert-Butyl 3-cyanomorpholine-4-carboxylate into synthetic pathways, chemists can access a wide range of complex and functionalized compounds, allowing for the development of novel materials and bioactive substances. Its strategic placement within a synthetic scheme enables efficient formation of intricate molecular structures, making it an indispensable tool for synthetic chemists seeking to explore new chemical possibilities.