
Catalog Number	AR00DBGH
Chemical Name	1-(2-naphthyl)-1H-pyrazole-4-carbaldehyde
CAS Number	518023-77-3
Molecular Formula	C14H10N2O
Molecular Weight	222.242
MDL Number	MFCD03780731
SMILES	O=Cc1cnn(c1)c1ccc2c(c1)cccc2

1-(Naphthalen-2-yl)-1H-pyrazole-4-carbaldehyde is a versatile compound that finds widespread application in chemical synthesis as a key intermediate. With its unique structure and functional groups, this compound serves as a valuable building block in the development of various organic molecules and pharmaceuticals. Its reactivity and ability to participate in diverse chemical reactions make it a valuable tool for the synthesis of complex organic compounds. In particular, its presence in the synthesis of heterocyclic compounds has garnered significant interest in the research community. Additionally, its potential as a precursor for the development of novel materials and bioactive compounds highlights its importance in the field of organic chemistry.