
Catalog Number	AR01DE3K
Chemical Name	Cycleanine
CAS Number	518-94-5
Molecular Formula	C38H42N2O6
Molecular Weight	622.7499
MDL Number	MFCD00238567
SMILES	COc1c(OC)cc2c3c1Oc1ccc(cc1)CC1N(C)CCc4c1c(Oc1ccc(CC3N(CC2)C)cc1)c(c(c4)OC)OC

(12aR,24aR)-2,3,12a,13,14,15,24,24a-Octahydro-5,6,17,18-tetramethoxy-1,13-dimethyl-8,11:20,23-dietheno-1H,12H-[1,10]dioxacyclooctadecino[2,3,4-ij:11,12,13-i'j']diisoquinoline is a versatile compound commonly employed in chemical synthesis as a key building block. Its unique structural features make it a valuable intermediate in the production of various complex organic molecules. This compound can participate in a range of reactions, including functional group transformations, cycloadditions, and ring-opening reactions, enabling the formation of intricate molecular frameworks. Its presence in a synthetic pathway can lead to the efficient construction of target molecules with diverse applications in pharmaceuticals, materials science, and agrochemicals. The controlled manipulation of this compound's functional groups and stereochemistry is crucial for the successful synthesis of highly specialized and biologically active compounds.