
Catalog Number	AR00DD7I
Chemical Name	5-(3-Methoxy-phenyl)-2H-pyrazole-3-carboxylic acid methyl ester
CAS Number	517870-26-7
Molecular Formula	C12H12N2O3
Molecular Weight	232.2353
MDL Number	MFCD07021285
SMILES	COc1cccc(c1)c1[nH]nc(c1)C(=O)OC

5-(3-METHOXY-PHENYL)-2H-PYRAZOLE-3-CARBOXYLIC ACID METHYL ESTER is a versatile compound commonly used in chemical synthesis for the development of pharmaceuticals, agrochemicals, and materials science. This compound serves as a key building block in the creation of various advanced organic molecules due to its unique structure and reactivity. In chemical synthesis, it acts as a valuable intermediate in the production of novel heterocyclic compounds with potential biological activities. Its functional groups allow for efficient derivatization, enabling the modification of its properties for specific applications. This compound has found particular utility in the synthesis of drug candidates and innovative materials, highlighting its importance in the field of organic chemistry.