
Catalog Number	AR00DWVO
Chemical Name	3-Formyl-9H-carbazole
CAS Number	51761-07-0
Molecular Formula	C13H9NO
Molecular Weight	195.2167
MDL Number	MFCD09743119
SMILES	O=Cc1ccc2c(c1)c1ccccc1[nH]2

Carbazole-3-carboxaldehyde plays a crucial role in chemical synthesis as a versatile building block. It serves as a key intermediate in the synthesis of various compounds, including pharmaceuticals, dyes, and materials. By utilizing the unique properties of Carbazole-3-carboxaldehyde, chemists are able to access diverse molecular structures through different chemical reactions. This compound can undergo transformations such as condensation, oxidation, and reduction to introduce specific functionalities into the target molecules. Its application in organic synthesis enables the efficient construction of complex molecules with tailored properties for a wide range of industrial and scientific purposes.