
Catalog Number	AR00DFAF
Chemical Name	2-Oxo-1,2-dihydro-[1,8]naphthyridine-3-carboxylic acid
CAS Number	5175-14-4
Molecular Formula	C9H6N2O3
Molecular Weight	190.1555
MDL Number	MFCD06659017
SMILES	OC(=O)c1cc2cccnc2[nH]c1=O

2-Oxo-1,2-dihydro-1,8-naphthyridine-3-carboxylic acid is a versatile compound widely utilized in organic chemical synthesis. This compound serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and specialty chemicals due to its unique structural properties. In chemical synthesis, it can be employed as a building block for creating complex structures with diverse functionalities. Its reactivity allows for the introduction of different functional groups, enabling the synthesis of novel compounds with potential biological activities. Additionally, 2-Oxo-1,2-dihydro-1,8-naphthyridine-3-carboxylic acid plays a crucial role in the development of new materials and the advancement of medicinal chemistry research. Its utility in custom synthesis makes it a valuable component in the creation of molecular libraries for drug discovery and lead optimization processes.