
Catalog Number	AR00I9XY
Chemical Name	1,8-Naphthyridine-3-carboxylic acid, 1,2-dihydro-2-oxo-, ethyl ester
CAS Number	5174-90-3
Molecular Formula	C11H10N2O3
Molecular Weight	218.2087
MDL Number	MFCD06659016
SMILES	CCOC(=O)c1cc2cccnc2[nH]c1=O

Ethyl 2-oxo-1,2-dihydro-1,8-naphthyridine-3-carboxylate is a versatile compound widely used in chemical synthesis. It serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and materials due to its unique structural properties and reactivity. This compound is commonly employed as a precursor in the synthesis of novel heterocyclic compounds with potential biological activities. In organic chemistry, it acts as a valuable starting material for the construction of more complex molecules through cyclization reactions, condensations, and other transformations. Its ability to undergo diverse chemical reactions makes it a valuable tool for researchers and chemists engaged in the development of new compounds with desired properties.