
Catalog Number	AR00IN6V
Chemical Name	Glucotropaeolin potassium salt
CAS Number	5115-71-9
Molecular Formula	C14H18KNO9S2
Molecular Weight	447.5223
MDL Number	MFCD00153006
SMILES	OCC1OC(S/C(=N/OS(=O)(=O)[O-])/Cc2ccccc2)C(C(C1O)O)O.[K+]

Glucotropaeolin potassium salt, a key compound in chemical synthesis, plays a crucial role in various applications. In the realm of organic chemistry, it serves as a valuable precursor for the synthesis of bioactive compounds and pharmaceuticals. Its ability to undergo selective reactions and functional group transformations makes it a versatile tool for the creation of complex molecular structures. Furthermore, Glucotropaeolin potassium salt is utilized in the development of novel synthetic methodologies, enabling chemists to access new pathways for the construction of intricate molecules. Its significance in chemical synthesis extends to agrochemicals, where it serves as a building block for the production of pesticides and herbicides. This compound's versatility and reactivity make it a valuable asset in the hands of synthetic chemists striving to innovate and advance the field of chemical synthesis.