
Catalog Number	AR00D8YK
Chemical Name	FMOC-(R)-3-AMINO-3-(2-NAPHTHYL)-PROPIONIC ACID
CAS Number	511272-48-3
Molecular Formula	C28H23NO4
Molecular Weight	437.4865
MDL Number	MFCD03428029
SMILES	O=C(N[C@@H](c1ccc2c(c1)cccc2)CC(=O)O)OCC1c2ccccc2-c2c1cccc2

The application of (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(naphthalen-2-yl)propanoic acid in chemical synthesis lies primarily in its role as a chiral building block. With its specific stereochemistry and functional groups, this compound can serve as a key intermediate in the synthesis of complex molecules, particularly in the pharmaceutical and agrochemical industries. By incorporating this compound into the synthetic pathway, chemists can introduce chirality and specific structural features into target molecules with precision, enabling the production of enantiomerically pure compounds with desired biological activities. Additionally, the unique structural motifs present in (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(naphthalen-2-yl)propanoic acid offer opportunities for diversification through further chemical transformations, allowing for the creation of diverse compound libraries for drug discovery and development purposes.