
Catalog Number	AR00D8YJ
Chemical Name	FMOC-(R)-3-AMINO-3-(2,3-DICHLORO-PHENYL)-PROPIONIC ACID
CAS Number	511272-38-1
Molecular Formula	C24H19Cl2NO4
Molecular Weight	456.3180
MDL Number	MFCD03428019
SMILES	O=C(N[C@@H](c1cccc(c1Cl)Cl)CC(=O)O)OCC1c2ccccc2c2c1cccc2

The application of (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2,3-dichlorophenyl)propanoic acid in chemical synthesis involves its use as a chiral building block in the creation of complex organic molecules. By incorporating this compound into reaction pathways, chemists can introduce chirality and specific stereochemistry into their target molecules, enhancing their biological activity or properties. The presence of the fluorenyl group and the dichlorophenyl moiety in the structure provides unique reactivity and selectivity in various synthetic transformations, making it a valuable tool in the construction of pharmaceuticals, agrochemicals, and advanced materials.