
Catalog Number	AR00DB0J
Chemical Name	(1'S,2'S)-NICOTINE 1'-OXIDE
CAS Number	51095-86-4
Molecular Formula	C10H14N2O
Molecular Weight	178.231
MDL Number	MFCD00869528
SMILES	[O-][N@@+]1(C)CCC[C@H]1c1cccnc1

The compound (1S,2S)-1-Methyl-2-(pyridin-3-yl)pyrrolidin-1-ium-1-olate is widely utilized in chemical synthesis as a versatile reagent for various organic transformations. Its unique structure enables it to function as a chiral scaffold, allowing for the stereocontrolled synthesis of complex molecules. In asymmetric synthesis, this compound acts as a valuable catalyst or ligand, facilitating the formation of enantioenriched products. Additionally, (1S,2S)-1-Methyl-2-(pyridin-3-yl)pyrrolidin-1-ium-1-olate has been employed in the construction of heterocyclic frameworks and in the modification of natural products. Its role in promoting regioselective reactions and facilitating functional group interconversions makes it a valuable tool in the toolbox of synthetic chemists.