
Catalog Number	AR00DA1Y
Chemical Name	1-(4-METHOXY-BENZOYL)-PIPERIDINE-4-CARBOXYLIC ACID
CAS Number	510739-83-0
Molecular Formula	C14H17NO4
Molecular Weight	263.2891
MDL Number	MFCD01875804
SMILES	COc1ccc(cc1)C(=O)N1CCC(CC1)C(=O)O

1-(4-Methoxybenzoyl)piperidine-4-carboxylic acid, often referred to simply as $name$, plays a crucial role in chemical synthesis as a versatile building block. This compound is commonly utilized in the synthesis of pharmaceuticals, agrochemicals, and materials due to its unique structural features and reactivity.In organic synthesis, $name$ serves as a key intermediate for the preparation of various compounds with biological activities. Its piperidine moiety offers a valuable scaffold for the development of new drug candidates targeting a wide range of therapeutic areas. The incorporation of the 4-methoxybenzoyl group provides additional functionality that can be further modified to tune the properties of the final product.Furthermore, the carboxylic acid functionality in $name$ enables facile derivatization through amidation, esterification, or other chemical transformations. This flexibility allows for the introduction of diverse functional groups or modifications to the molecule, expanding its potential applications in synthesis.Overall, the strategic placement of the 4-methoxybenzoyl and piperidine groups in 1-(4-Methoxybenzoyl)piperidine-4-carboxylic acid offers chemists a valuable tool for designing and synthesizing novel compounds with tailored properties for various purposes, making it a valuable asset in the field of chemical synthesis.