
Catalog Number	AR003GD2
Chemical Name	2,4,6-Triphenylpyrylium hydrogensulfate
CAS Number	51071-75-1
Molecular Formula	C23H18O5S
Molecular Weight	406.4510
MDL Number	MFCD00012002
SMILES	c1ccc(cc1)c1cc([o+]c(c1)c1ccccc1)c1ccccc1.[O-]S(=O)(=O)O

2,4,6-Triphenylpyrylium hydrogensulfate, also known as TPPHS, is a versatile compound widely used in chemical synthesis. This unique chemical plays a crucial role in various reactions due to its ability to act as an efficient oxidizing agent. In organic synthesis, TPPHS is commonly utilized as a mild oxidant for the conversion of alcohols to carbonyl compounds. Additionally, it can also facilitate the oxidative dearomatization of aromatic compounds to form complex structures with potential pharmaceutical applications. With its remarkable reactivity and compatibility with a wide range of substrates, 2,4,6-Triphenylpyrylium hydrogensulfate has become a valuable tool for synthetic chemists seeking to streamline their processes and access novel chemical entities.