
Catalog Number	AR00DARD
Chemical Name	Amcinonide
CAS Number	51022-69-6
Molecular Formula	C28H35FO7
Molecular Weight	502.5717
MDL Number	MFCD00213379
SMILES	CC(=O)OCC(=O)[C@@]12OC3(O[C@@H]1C[C@@H]1[C@]2(C)C[C@H](O)[C@]2([C@H]1CCC1=CC(=O)C=C[C@]21C)F)CCCC3

Amcinonide is a potent synthetic corticosteroid that finds its application in chemical synthesis as an important intermediate for the production of pharmaceutical compounds. As a corticosteroid, Amcinonide exhibits anti-inflammatory and immunosuppressive properties, making it a valuable component in the synthesis of medications used to treat a variety of skin conditions such as eczema, psoriasis, and dermatitis. In chemical synthesis, Amcinonide serves as a key building block for creating more complex molecules that target specific receptors in the body, ultimately aiding in the development of innovative pharmaceutical products. Its precise structure and reactivity make it a versatile tool for chemists and researchers in the synthesis of novel drug compounds with enhanced therapeutic effects and reduced side effects.