
Catalog Number	AR00D8MS
Chemical Name	D-BASE
CAS Number	50961-68-7
Molecular Formula	C9H14N2O2
Molecular Weight	182.2197
MDL Number	MFCD00238534
SMILES	OC[C@@H]([C@H](c1ccc(cc1)N)O)N

The (1S,2S)-2-Amino-1-(4-aminophenyl)propane-1,3-diol, or $name$, is a versatile compound that finds significant utility in chemical synthesis. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals due to its unique structure and reactivity.One prominent application of $name$ in chemical synthesis is its use as a chiral auxiliary. As a chiral compound itself, it can impart stereochemical control in asymmetric synthesis processes. By selectively manipulating the stereochemistry of $name$, chemists can influence the stereochemistry of the final product, enabling the synthesis of optically pure compounds with high enantiomeric excess.Additionally, $name$ can act as a ligand in transition metal-catalyzed reactions, facilitating complexation with metal ions to form catalytically active species. This enables the development of efficient catalytic processes for the synthesis of intricate organic molecules, including pharmaceutical intermediates and natural products.Overall, the unique structural features and reactivity of (1S,2S)-2-Amino-1-(4-aminophenyl)propane-1,3-diol make it a valuable tool in chemical synthesis, enabling the creation of diverse and complex compounds with tailored stereochemistry and functionality.