
Catalog Number	AR00DFAU
Chemical Name	6-HYDROXY-2-METHYL-QUINOLINE-4-CARBOXYLIC ACID
CAS Number	50741-53-2
Molecular Formula	C11H9NO3
Molecular Weight	203.1941
MDL Number	MFCD00459572
SMILES	Oc1ccc2c(c1)c(cc(n2)C)C(=O)O

6-Hydroxy-2-methylquinoline-4-carboxylic acid is a versatile organic compound that plays a crucial role in chemical synthesis. This compound is commonly utilized as a building block in the preparation of various pharmaceuticals, agrochemicals, and other fine chemicals.In chemical synthesis, 6-Hydroxy-2-methylquinoline-4-carboxylic acid serves as a key intermediate for the synthesis of biologically active compounds. Its unique structure allows for functional group manipulations and diverse chemical transformations, making it an essential component in the creation of complex organic molecules.Furthermore, the presence of both hydroxy and carboxylic acid groups on the quinoline ring provides opportunities for selective reactions and selective derivatization, enabling chemists to tailor the compound for specific applications.Overall, 6-Hydroxy-2-methylquinoline-4-carboxylic acid is a valuable tool in chemical synthesis, enabling the efficient construction of intricate molecular structures with potential pharmacological and agricultural significance.