
Catalog Number	AR01EWWE
Chemical Name	5-(4-Isobutylphenyl)-2H-pyrazol-3-ylamine
CAS Number	501902-78-9
Molecular Formula	C13H17N3
Molecular Weight	215.2942
MDL Number	MFCD02664132
SMILES	CC(Cc1ccc(cc1)c1n[nH]c(c1)N)C

5-[4-(2-Methylpropyl)phenyl]-1H-pyrazol-3-amine is a versatile compound frequently utilized in chemical synthesis for the preparation of various pharmaceuticals, agrochemicals, and functional materials. This compound serves as a key building block in the synthesis of biologically active molecules and complex organic structures due to its unique chemical properties. Its significance lies in its ability to undergo diverse reactions, such as substitution, addition, and cyclization, leading to the formation of a wide range of novel compounds with potential applications in drug discovery and material science. Through its strategic incorporation into synthetic pathways, 5-[4-(2-Methylpropyl)phenyl]-1H-pyrazol-3-amine enables chemists to access structurally diverse compounds with enhanced biological activities or tailored physical properties, making it an essential tool in modern chemical synthesis.