
Catalog Number	AR00JCWJ
Chemical Name	1-(2,3,4-trimethoxybenzyl)piperazine
CAS Number	5011-34-7
Molecular Formula	C14H22N2O3
Molecular Weight	266.3361
MDL Number	MFCD00868263
SMILES	COc1c(ccc(c1OC)OC)CN1CCNCC1

Trimetazidine is a valuable compound in chemical synthesis, particularly in the field of medicinal chemistry. It serves as a key building block for the synthesis of various pharmaceuticals with therapeutic properties. Its unique structure and reactivity make it a versatile intermediate in the production of drugs that target conditions such as angina, heart failure, and other cardiovascular disorders. By incorporating Trimetazidine into complex molecular structures, chemists can modulate the pharmacological activities of resulting compounds, enhancing their efficacy and selectivity for specific biological targets. Additionally, its presence in the chemical synthesis process can influence the physicochemical properties of the final products, thereby contributing to improved drug delivery and bioavailability. In summary, Trimetazidine plays a crucial role in the innovative design and development of pharmaceuticals with enhanced therapeutic potential.