
Catalog Number	AR00I9M0
Chemical Name	Vasopressin, 8-L-lysine-
CAS Number	50-57-7
Molecular Formula	C46H65N13O12S2
Molecular Weight	1056.2182
MDL Number	MFCD00076754
SMILES	NCCCC[C@@H](C(=O)NCC(=O)N)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](Cc2ccc(cc2)O)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1)CC(=O)N)CCC(=O)N)Cc1ccccc1

Vasopressin, 8-L-lysine- is a versatile peptide that finds wide application in chemical synthesis processes. This compound is commonly used as a reagent in peptide synthesis due to its unique properties. Its lysine residue serves as an essential anchor point for conjugation with other molecules or polymers, allowing for the creation of complex peptide structures.In chemical synthesis, Vasopressin, 8-L-lysine- acts as a building block for the assembly of various peptides with specific sequences and functionalities. By incorporating this compound into the synthesis process, researchers can tailor the properties of the resulting peptides to meet diverse research or industrial needs. Additionally, the L-lysine moiety in Vasopressin provides enhanced stability and structural integrity to the synthesized peptides, ensuring their efficacy in different applications.Overall, Vasopressin, 8-L-lysine- plays a crucial role in advancing peptide chemistry by enabling the efficient and precise synthesis of custom peptides with desired characteristics. Its applications extend across the fields of pharmaceuticals, materials science, and biotechnology, driving innovation and discovery in diverse industries.