
Catalog Number	AR00D8ZF
Chemical Name	BOC-(S)-3-AMINO-3-(2-HYDROXY-PHENYL)-PROPIONIC ACID
CAS Number	499995-78-7
Molecular Formula	C14H19NO5
Molecular Weight	281.3044
MDL Number	MFCD03427901
SMILES	OC(=O)C[C@@H](c1ccccc1O)NC(=O)OC(C)(C)C

The (S)-3-((tert-Butoxycarbonyl)amino)-3-(2-hydroxyphenyl)propanoic acid, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. This compound is highly valued in organic chemistry for its ability to serve as a chiral precursor in the synthesis of various pharmaceuticals, natural products, and complex molecules.One of the key applications of (S)-3-((tert-Butoxycarbonyl)amino)-3-(2-hydroxyphenyl)propanoic acid is in asymmetric synthesis, where its chiral nature allows for the production of enantiomerically pure compounds. By utilizing this compound as a starting material, chemists can access specific enantiomers with high optical purity, essential for drug development and other industries requiring precise stereochemistry.In addition to its role in asymmetric synthesis, (S)-3-((tert-Butoxycarbonyl)amino)-3-(2-hydroxyphenyl)propanoic acid is also utilized in peptide synthesis. The tert-butoxycarbonyl (Boc) protecting group enhances the stability of the amino acid during the reaction steps, enabling the selective modification of peptides and proteins. This compound's unique structure with a phenolic hydroxyl group further expands its synthetic utility in constructing diverse molecular scaffolds and functionalized building blocks.Overall, (S)-3-((tert-Butoxycarbonyl)amino)-3-(2-hydroxyphenyl)propanoic acid is a valuable tool in the hands of synthetic chemists, enabling the efficient and precise synthesis of complex molecules with desired stereochemistry and functionality.