
Catalog Number	AR00DCJP
Chemical Name	1,3-Cyclohexanediamine, dihydrochloride, (1R,3S)-rel-
CAS Number	498532-32-4
Molecular Formula	C6H16Cl2N2
Molecular Weight	187.1106
MDL Number	MFCD01667588
SMILES	N[C@@H]1CCC[C@@H](C1)N.Cl.Cl

(1R,3S)-rel-Cyclohexane-1,3-diamine dihydrochloride is a versatile compound widely utilized in chemical synthesis as a chiral building block. Its unique stereochemistry allows for precise control over the spatial arrangement of functional groups in organic molecules, making it a valuable tool in the preparation of pharmaceuticals, agrochemicals, and advanced materials.In organic synthesis, (1R,3S)-rel-Cyclohexane-1,3-diamine dihydrochloride serves as a key component in the construction of complex molecules with specific three-dimensional structures. Its chiral nature imparts asymmetry to reactions, enabling the selective formation of enantiomerically pure compounds. This is particularly crucial in the pharmaceutical industry, where the biological activity of drugs often depends on the spatial arrangement of their constituent atoms.Furthermore, (1R,3S)-rel-Cyclohexane-1,3-diamine dihydrochloride can be employed as a ligand in transition metal-catalyzed reactions, facilitating asymmetric catalysis. By coordinating with metal ions, it enhances the enantioselectivity and efficiency of various transformations, such as asymmetric hydrogenation and cycloaddition reactions. This results in the production of valuable intermediates and fine chemicals with high optical purity.Overall, the use of (1R,3S)-rel-Cyclohexane-1,3-diamine dihydrochloride in chemical synthesis offers a powerful strategy for accessing structurally complex and stereochemically defined compounds, thereby advancing research and development efforts across diverse scientific disciplines.