
Catalog Number	AR00I9KZ
Chemical Name	1H-Indole-3-acetic acid, 5-fluoro-, methyl ester
CAS Number	497258-29-4
Molecular Formula	C11H10FNO2
Molecular Weight	207.2010
MDL Number	MFCD24394199
SMILES	COC(=O)Cc1c[nH]c2c1cc(F)cc2

Methyl 5-Fluoroindole-3-acetate is a versatile chemical compound that plays a crucial role in chemical synthesis. In organic chemistry, this compound is commonly used as a key intermediate in the preparation of various pharmaceuticals and agrochemicals. Its unique structure and reactivity make it a valuable building block for the synthesis of complex molecules.One important application of Methyl 5-Fluoroindole-3-acetate is in the synthesis of biologically active compounds. By incorporating this compound into a synthetic pathway, chemists can introduce the fluorine atom at a specific position on the indole ring, which can significantly impact the compound's properties and biological activity. This ability to selectively modify molecules is critical in drug discovery and development.Furthermore, Methyl 5-Fluoroindole-3-acetate can also serve as a starting material for the synthesis of novel materials with desired properties. By manipulating its chemical structure through various reactions, researchers can tailor the physical and chemical characteristics of the final product for specific applications in materials science and industry.Overall, the versatility and reactivity of Methyl 5-Fluoroindole-3-acetate make it an indispensable tool in chemical synthesis, enabling the efficient construction of diverse molecular structures with applications across various fields of science and industry.