
Catalog Number	AR00DEIE
Chemical Name	Z-His-Nhnh2
CAS Number	49706-31-2
Molecular Formula	C14H17N5O3
Molecular Weight	303.3165
MDL Number	MFCD00038621
SMILES	NNC(=O)[C@H](Cc1c[nH]cn1)NC(=O)OCc1ccccc1

(S)-Benzyl (1-hydrazinyl-3-(1H-imidazol-4-yl)-1-oxopropan-2-yl)carbamate is a versatile compound that finds valuable applications in chemical synthesis. Its unique structure containing a benzyl group, a hydrazine moiety, and an imidazole ring imparts specific reactivity that makes it a useful building block in the creation of complex organic molecules.In chemical synthesis, (S)-Benzyl (1-hydrazinyl-3-(1H-imidazol-4-yl)-1-oxopropan-2-yl)carbamate can serve as a chiral auxiliary, facilitating the stereocontrolled synthesis of various compounds. By utilizing the chirality of this compound, chemists can selectively direct the formation of desired enantiomers in asymmetric transformations.Furthermore, the hydrazine functionality in this compound can participate in various types of reactions, such as hydrazone formation or reduction processes, enabling the introduction of nitrogen-containing motifs into target molecules. The presence of the imidazole ring also adds diversity to the reactivity profile of this compound, allowing for the formation of heterocyclic structures in the final products.Overall, (S)-Benzyl (1-hydrazinyl-3-(1H-imidazol-4-yl)-1-oxopropan-2-yl)carbamate serves as a valuable tool for organic chemists seeking to access complex, chiral molecules through strategic and controlled synthetic pathways.