
Catalog Number	AR00DL8J
Chemical Name	2,4-dinitro-3-phenyl-L-alanine
CAS Number	49607-21-8
Molecular Formula	C9H9N3O6
Molecular Weight	255.1843
MDL Number	MFCD08061615
SMILES	OC(=O)[C@H](Cc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])N

2,4-Dinitro-L-phenylalanine, also known as DNP, is a versatile compound widely used in chemical synthesis for its unique properties. In organic chemistry, it serves as a valuable building block for the synthesis of various aromatic compounds and pharmaceutical intermediates. Its high reactivity makes it a key component in the preparation of complex molecules, allowing chemists to efficiently create new compounds with specific structures and functions. Furthermore, 2,4-Dinitro-L-phenylalanine can be utilized as a precursor for the synthesis of specialized materials and polymers, demonstrating its importance in diverse research fields. Additionally, its distinct chemical properties make it a valuable tool for investigating reaction mechanisms and exploring new synthetic routes, further highlighting its significance in chemical synthesis.