
Catalog Number	AR00DCS2
Chemical Name	(5R)-5-(Chloromethyl)-3-[3-fluoro-4-(4-morpholinyl)phenyl]-2-oxazolidinone
CAS Number	496031-57-3
Molecular Formula	C14H16ClFN2O3
Molecular Weight	314.7398
MDL Number	MFCD22683177
SMILES	ClC[C@@H]1OC(=O)N(C1)c1ccc(c(c1)F)N1CCOCC1

$Name$ is a versatile compound that plays a crucial role in chemical synthesis. Specifically, (R)-5-(Chloromethyl)-3-(3-fluoro-4-morpholinophenyl)oxazolidin-2-one is utilized as a key building block in the creation of complex organic molecules. Its unique structure allows it to participate in various reactions, enabling the formation of new carbon-carbon and carbon-heteroatom bonds.One important application of this compound is its use in the synthesis of pharmaceuticals. By incorporating (R)-5-(Chloromethyl)-3-(3-fluoro-4-morpholinophenyl)oxazolidin-2-one into drug molecules, chemists can fine-tune the properties and biological activities of the resulting compounds. This compound's ability to introduce specific functional groups and stereochemistry makes it a valuable tool in the design and development of novel therapeutic agents.Additionally, (R)-5-(Chloromethyl)-3-(3-fluoro-4-morpholinophenyl)oxazolidin-2-one is employed in the preparation of advanced materials, agrochemicals, and specialty chemicals. Its reactivity and compatibility with a wide range of synthetic methodologies make it an indispensable component in the toolkit of synthetic chemists exploring diverse research areas.In summary, (R)-5-(Chloromethyl)-3-(3-fluoro-4-morpholinophenyl)oxazolidin-2-one serves as a valuable building block in chemical synthesis, enabling the construction of complex molecules with tailored properties and applications.