
Catalog Number	AR00DEMZ
Chemical Name	3,4-DIMETHOXY-6-NITROBENZAMIDE
CAS Number	4959-60-8
Molecular Formula	C9H10N2O5
Molecular Weight	226.1861
MDL Number	MFCD00171550
SMILES	COc1cc([N+](=O)[O-])c(cc1OC)C(=O)N

4,5-Dimethoxy-2-nitrobenzamide is a valuable compound widely utilized in chemical synthesis for its unique properties. In organic chemistry, this particular compound is frequently employed as a key precursor in the synthesis of various other organic molecules. Due to its specific structure and reactivity, 4,5-Dimethoxy-2-nitrobenzamide serves as an essential building block in the creation of complex pharmaceuticals, agrochemicals, and materials. Its distinctive chemical composition enables selective functional group transformations and facilitates the formation of intricate molecular architectures. Chemists rely on 4,5-Dimethoxy-2-nitrobenzamide to introduce specific functionalities or structural motifs into target molecules with precision, thus playing a crucial role in the advancement of modern chemical synthesis strategies.