
Catalog Number	AR00DATR
Chemical Name	2H-Pyran-2-one,6-[(1E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5,6-dihydro-4-methoxy-, (6R)-
CAS Number	495-85-2
Molecular Formula	C15H14O5
Molecular Weight	274.2687
MDL Number	MFCD21364778
SMILES	COC1=CC(=O)OC(C1)C=Cc1ccc2c(c1)OCO2
NSC Number	112158

In chemical synthesis, (+)-Methysticin serves as a valuable chiral building block due to its unique stereochemistry. This compound is utilized as a key intermediate in the production of various pharmaceuticals, agrochemicals, and natural products. Its asymmetric structure enables precise control over the stereochemistry of the final product, making it a versatile tool for creating complex organic molecules with high selectivity. By incorporating (+)-Methysticin into synthetic pathways, chemists can efficiently access enantiomerically pure compounds for use in drug discovery, material science, and other applications requiring chirality control. Additionally, the ability to manipulate the configuration of (+)-Methysticin through synthetic transformations offers opportunities to explore new chemical reactions and develop innovative synthetic methodologies.