
Catalog Number	AR00DGYP
Chemical Name	1-N-BOC-4-N-BENZYL-2-BENZYL PIPERAZINE
CAS Number	489437-72-1
Molecular Formula	C23H30N2O2
Molecular Weight	366.4965
MDL Number	MFCD09037815
SMILES	O=C(N1CCN(CC1Cc1ccccc1)Cc1ccccc1)OC(C)(C)C

The tert-Butyl 2,4-dibenzylpiperazine-1-carboxylate is a versatile compound commonly employed in chemical synthesis as a key intermediate in various reactions. Its unique structure, with a bulky tert-butyl group and two benzyl groups attached to the piperazine ring, provides specific steric and electronic properties that are crucial in the preparation of complex organic molecules.In organic synthesis, tert-Butyl 2,4-dibenzylpiperazine-1-carboxylate serves as a valuable reagent for the preparation of diverse compounds such as pharmaceuticals, agrochemicals, and materials. Its piperazine core can undergo functionalization reactions to introduce different chemical groups, while the tert-butyl and benzyl groups offer protection to specific functional groups during multi-step synthesis processes. This compound is particularly useful in the creation of bioactive molecules or building blocks with intricate structures, where control over regioselectivity and stereochemistry is essential for the desired product formation.Moreover, tert-Butyl 2,4-dibenzylpiperazine-1-carboxylate can participate in various coupling reactions, such as amide bond formation or cross-coupling reactions, enabling the construction of complex molecular frameworks. Its presence as a key intermediate in chemical transformations highlights its significance in enabling the efficient and selective synthesis of target compounds with tailored properties and functionalities.