
Catalog Number	AR00DLVM
Chemical Name	(-)-4-[4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile
CAS Number	488787-59-3
Molecular Formula	C20H23FN2O2
Molecular Weight	342.4072
MDL Number	MFCD16661208
SMILES	OCc1cc(C#N)ccc1[C@@](c1ccc(cc1)F)(CCCN(C)C)O

The compound (S)-4-(4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile, commonly known as $name$, is a versatile intermediate used in chemical synthesis. Its unique structure allows for diverse applications in organic chemistry, particularly in the development of pharmaceuticals and fine chemicals. Due to its specific stereochemistry and functional groups, (S)-4-(4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile serves as a key building block in the synthesis of bioactive compounds and complex molecules. Its ability to participate in various reactions and form new bonds makes it a valuable tool for researchers and chemists working on the design and production of novel substances with potential therapeutic or industrial applications.