
Catalog Number	AR00DFIC
Chemical Name	Sitagliptin N-Boc IMpurity
CAS Number	486460-23-5
Molecular Formula	C21H23F6N5O3
Molecular Weight	507.4294
MDL Number	MFCD29044848
SMILES	O=C(OC(C)(C)C)N[C@H](Cc1cc(F)c(cc1F)F)CC(=O)N1CCn2c(C1)nnc2C(F)(F)F

The (R)-tert-Butyl (4-oxo-4-(3-(trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl)-1-(2,4,5-trifluorophenyl)butan-2-yl)carbamate compound plays a crucial role in chemical synthesis due to its versatile applications. This compound is commonly employed as a reagent in organic chemistry reactions, particularly in the formation of complex heterocyclic structures. The presence of the (R)-tert-Butyl group provides steric hindrance, influencing the regioselectivity and stereochemistry of reactions. Additionally, the carbamate moiety can participate in various transformations, such as amidation or carbamoylation reactions, expanding the compound's synthetic utility. Furthermore, the trifluoromethyl and trifluorophenyl substituents enhance the compound's reactivity and compatibility in modern synthetic methodologies, making it a valuable building block in drug discovery and material science research.