
Catalog Number	AR00D9UT
Chemical Name	(R)-3-N-Boc-Amino-1-Cbz-piperidine
CAS Number	485820-12-0
Molecular Formula	C18H26N2O4
Molecular Weight	334.41
MDL Number	MFCD11053521
SMILES	O=C(OC(C)(C)C)N[C@@H]1CCCN(C1)C(=O)OCc1ccccc1

$Name$ is a valuable intermediate in chemical synthesis, specifically in the realm of peptide and pharmaceutical manufacturing. Its (R)-3-N-Boc-Amino-1-Cbz-piperidine structure lends itself well to a variety of reactions, allowing for the selective modification of functional groups to create complex molecules. This compound serves as a crucial building block in the creation of peptides, which are essential in drug development and biological research. By incorporating (R)-3-N-Boc-Amino-1-Cbz-piperidine into a synthetic pathway, chemists can precisely control the stereochemistry and functionality of the final product, leading to the production of high-quality compounds with specific biological activities.