
Catalog Number	AR006XEU
Chemical Name	Graveoline
CAS Number	485-61-0
Molecular Formula	C17H13NO3
Molecular Weight	279.29
MDL Number	MFCD00236478
SMILES	Cn1c(cc(=O)c2c1cccc2)c1ccc2c(c1)OCO2

2-(Benzo[d][1,3]dioxol-5-yl)-1-methylquinolin-4(1H)-one is a versatile compound used in chemical synthesis as a key building block in the creation of various pharmaceuticals, agrochemicals, and materials. Its unique structure containing a benzodioxole moiety and a quinoline ring makes it a valuable intermediate in the synthesis of complex organic molecules.This compound is particularly valuable in the field of medicinal chemistry, where it serves as a crucial starting material for the synthesis of novel drug candidates. Its presence in the molecular structure imparts desirable pharmacological properties, making it a sought-after component in the development of new therapeutics targeting various diseases.Furthermore, 2-(Benzo[d][1,3]dioxol-5-yl)-1-methylquinolin-4(1H)-one finds applications in the synthesis of specialty chemicals and advanced materials due to its ability to undergo various chemical transformations, enabling the creation of diverse organic compounds with tailored properties and functionalities. Its use in chemical synthesis highlights its importance in driving innovation and advancements in the field of organic chemistry.