
Catalog Number	AR003BXQ
Chemical Name	6-Nitrobenzo[d]thiazole-2(3H)-thione
CAS Number	4845-58-3
Molecular Formula	C7H4N2O2S2
Molecular Weight	212.2489
MDL Number	MFCD00041850
SMILES	[O-][N+](=O)c1ccc2c(c1)sc(=S)[nH]2
NSC Number	2630

2-Mercapto-6-Nitrobenzothiazole is a versatile chemical compound that finds extensive application in chemical synthesis processes. As a key reagent, it plays a crucial role in various reactions due to its unique properties. When used in organic synthesis, 2-Mercapto-6-Nitrobenzothiazole serves as a building block in the creation of complex molecules. Its thiol group can participate in nucleophilic substitution reactions, leading to the formation of new carbon-sulfur bonds. Additionally, the nitro group in its structure enables it to act as a nitronate anion precursor, which can undergo further transformations, such as reductions or nucleophilic additions, to yield diverse products. Due to its ability to introduce both sulfur and nitro functional groups into molecules, 2-Mercapto-6-Nitrobenzothiazole is a valuable tool in the synthesis of pharmaceuticals, agrochemicals, and materials with specific properties. Its role in chemical synthesis extends beyond just reacting with other compounds; it also serves as a catalyst in certain reactions, accelerating reaction rates and influencing selectivity. The versatility and reactivity of 2-Mercapto-6-Nitrobenzothiazole make it a vital component in the toolbox of organic chemists seeking to design and create novel compounds with tailored properties and functionalities.