
Catalog Number	AR00DLAH
Chemical Name	Methyl 3-Methyl-5-nitrobenzoate
CAS Number	482311-23-9
Molecular Formula	C9H9NO4
Molecular Weight	195.1721
MDL Number	MFCD12172988
SMILES	COC(=O)c1cc(C)cc(c1)[N+](=O)[O-]

Methyl 3-methyl-5-nitrobenzoate is a versatile compound commonly used in chemical synthesis as a key intermediate in the production of various pharmaceuticals, agrochemicals, and dyes. Due to its unique chemical structure, this compound serves as a crucial building block in the synthesis of complex organic molecules. Its reactivity and functional groups make it an important component in the creation of diverse compounds with a range of biological and industrial applications. By serving as a precursor in various synthetic routes, Methyl 3-methyl-5-nitrobenzoate plays a significant role in the development of new and innovative materials and substances in the field of chemistry. Its strategic position in the synthesis process highlights its importance in the creation of novel compounds with potential benefits across different industries.