
Catalog Number	AR00DFSR
Chemical Name	N4-Anisoyl-2'-deoxycytidine
CAS Number	48212-99-3
Molecular Formula	C17H19N3O6
Molecular Weight	361.3493
MDL Number	MFCD00043145
SMILES	OC[C@H]1O[C@H](C[C@@H]1O)n1ccc(nc1=O)NC(=O)c1ccc(cc1)OC

N4-Anisoyl-2'-deoxycytidine is a valuable compound in chemical synthesis, frequently utilized as a versatile building block in the creation of complex organic molecules. This compound plays a crucial role in the construction of nucleoside analogs and pharmaceutical intermediates due to its unique reactivity and structural properties. By incorporating N4-Anisoyl-2'-deoxycytidine into synthetic pathways, chemists can efficiently introduce specific functional groups and modifications to target molecules, enhancing their biological or chemical properties. The use of this compound in chemical synthesis enables the development of novel drug candidates, agrochemicals, and materials with tailored characteristics and enhanced performance.