
Catalog Number	AR00DFZG
Chemical Name	A-SPINASTEROL
CAS Number	481-18-5
Molecular Formula	C29H48O
Molecular Weight	412.69082000000003
MDL Number	MFCD00200554
SMILES	CC[C@@H](C(C)C)/C=C/[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1C2=CC[C@@H]2[C@]1(C)CC[C@@H](C2)O)C

Alpha-Spinasterol, a phytosterol compound derived from plants, plays a crucial role in chemical synthesis when used as a starting material or intermediate. In organic chemistry, alpha-Spinasterol can be utilized for the synthesis of various bioactive molecules, pharmaceuticals, and functional materials. Its unique structure and functional groups make it a versatile precursor in the preparation of novel compounds with potential pharmacological activities. Whether employed as a chiral building block or a key reagent, alpha-Spinasterol contributes to the development of innovative synthetic pathways and the creation of diverse chemical entities. By harnessing the reactivity and stereochemical properties of alpha-Spinasterol, chemists can access a wide array of molecular scaffolds for applications in drug discovery, material science, and beyond.