
Catalog Number	AR00DCID
Chemical Name	Potassium 2-bromophenyltrifluoroborate
CAS Number	480445-38-3
Molecular Formula	C6H4BBrF3K
Molecular Weight	262.9045
MDL Number	MFCD08276753
SMILES	Brc1ccccc1[B-](F)(F)F.[K+]

Potassium 2-bromophenyltrifluoroborate is a versatile chemical reagent commonly employed in organic synthesis due to its unique properties and reactivity. This compound serves as a valuable source of the 2-bromophenyltrifluoroborate functional group, which is a powerful nucleophilic building block in various synthetic transformations.In chemical synthesis, Potassium 2-bromophenyltrifluoroborate is frequently utilized in cross-coupling reactions, particularly in Suzuki-Miyaura coupling reactions. This reaction involves the coupling of an aryl or vinyl boronate with an organic halide or pseudohalide, resulting in the formation of a new carbon-carbon bond. The 2-bromophenyltrifluoroborate moiety acts as a key component in these reactions, providing a facile route to the introduction of phenyl and trifluoroborate functionalities into organic molecules.Additionally, Potassium 2-bromophenyltrifluoroborate can participate in other types of transformations, such as nucleophilic aromatic substitution reactions and transition metal-catalyzed processes. Its compatibility with a wide range of functional groups and substrates make it a valuable tool for the synthesis of complex organic molecules in both academic research and industrial settings.Overall, the application of Potassium 2-bromophenyltrifluoroborate in chemical synthesis offers chemists a powerful and reliable method for the construction of diverse molecular scaffolds with high efficiency and precision.