
Catalog Number	AR0034NX
Chemical Name	4-carboxybenzediazonium tetrafluoroborate
CAS Number	456-25-7
Molecular Formula	C7H5BF4N2O2
Molecular Weight	235.9314
MDL Number	MFCD10567340
SMILES	F[B-](F)(F)F.N#[N+]c1ccc(cc1)C(=O)O

4-Carboxybenzediazonium tetrafluoroborate is a versatile compound commonly used in chemical synthesis for its unique reactivity and utility in various reactions. One of its key applications is in the formation of aromatic compounds through diazo coupling reactions. By reacting with different nucleophiles, such as phenols or aromatic amines, 4-carboxybenzediazonium tetrafluoroborate facilitates the synthesis of substituted aromatic products. This reaction is particularly valuable in the pharmaceutical industry for the preparation of bioactive compounds and in material science for generating functionalized aromatics with tailored properties. Additionally, this compound can be employed in the fabrication of organic electronic materials and dyes, highlighting its importance in diverse areas of chemistry.