
Catalog Number	AR00C0BD
Chemical Name	3-METHYL-3-(4-METHYLPHENYL)BUTANOIC ACID
CAS Number	42288-08-4
Molecular Formula	C12H16O2
Molecular Weight	192.2542
MDL Number	MFCD03844683
SMILES	OC(=O)CC(c1ccc(cc1)C)(C)C

3-Methyl-3-(p-tolyl)butanoic acid is a versatile compound commonly utilized in chemical synthesis for its valuable applications. This compound serves as an important building block in organic chemistry, particularly in the development of pharmaceuticals, agrochemicals, and materials science. Its structural properties make it an ideal precursor for the synthesis of various derivatives with diverse functionalities. In organic synthesis, 3-Methyl-3-(p-tolyl)butanoic acid can be used as a key intermediate in the preparation of complex molecules through various transformations such as esterification, amidation, and hydrogenation. Its unique structure provides opportunities for selective modifications and stereochemical control, making it a valuable tool in designing and creating novel chemical compounds for a wide range of applications. Its versatility and utility make it a valuable asset in the toolkit of synthetic chemists seeking to develop new chemical entities with potential therapeutic, agricultural, or industrial significance.